C34H21N7 — CID 67104657
5,10,15-tripyridin-2-yl-21H-corrin (PubChem CID 67104657) has the molecular formula C34H21N7 and a molecular weight of 527.59 g/mol. Its IUPAC name is 5,10,15-tripyridin-2-yl-21H-corrin.
| Compound Name | 5,10,15-tripyridin-2-yl-21H-corrin |
|---|---|
| PubChem CID | 67104657 |
| Molecular Formula | C34H21N7 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 5,10,15-tripyridin-2-yl-21H-corrin |
| SMILES | C1=C/C2=C(\c3ccccn3)C3=N/C(=c4/cc/c([nH]4)=C(\c4ccccn4)C4=N/C(=C(/c5ccccn5)C1=N2)C=C4)C=C3 |
| InChI | InChI=1S/C34H21N7/c1-4-18-35-23(7-1)32-26-12-10-21(38-26)22-11-13-27(39-22)33(24-8-2-5-19-36-24)29-15-17-31(41-29)34(25-9-3-6-20-37-25)30-16-14-28(32)40-30/h1-20,38H/b22-21-,32-26-,32-28-,33-27-,33-29-,34-30-,34-31- |
| InChIKey | BBFILLDNTYKHKW-IIPUVCDPSA-N |
| XLogP | 4.38 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |