C48H41N3 — CID 142967395
(2Z,6Z,11Z,17E)-21-ethyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.2.2.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene;molecular hydrogen (PubChem CID 142967395) has the molecular formula C48H41N3 and a molecular weight of 659.88 g/mol. Its IUPAC name is (2Z,6Z,11Z,17E)-21-ethyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.2.2.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene;molecular hydrogen.
| Compound Name | (2Z,6Z,11Z,17E)-21-ethyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.2.2.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene;molecular hydrogen |
|---|---|
| PubChem CID | 142967395 |
| Molecular Formula | C48H41N3 |
| Molecular Weight | 659.88 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | (2Z,6Z,11Z,17E)-21-ethyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.2.2.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene;molecular hydrogen |
| SMILES | CCC1=C2C=C/C(=C(\c3ccccc3)c3ccc([nH]3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=c3/cc/c([nH]3)=C/2c2ccccc2)C1.[H][H].[H][H] |
| InChI | InChI=1S/C48H37N3.2H2/c1-2-32-31-37-23-24-38(32)46(34-17-9-4-10-18-34)40-26-28-42(50-40)48(36-21-13-6-14-22-36)44-30-29-43(51-44)47(35-19-11-5-12-20-35)41-27-25-39(49-41)45(37)33-15-7-3-8-16-33;;/h3-30,49-50H,2,31H2,1H3;2*1H/b45-37-,46-40-,47-43-,48-42-;; |
| InChIKey | MSJVNQCXTIYBGG-MSZPXVNYSA-N |
| XLogP | 10.19 |
| TPSA | 43.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.88 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |