C44H34N4O — CID 154526848
(1Z,5Z,9Z,14Z)-20-cyclohexa-1,3-dien-1-yl-5,10,15-triphenyl-4,21,22,24-tetrahydroporphyrin-2-ol (PubChem CID 154526848) has the molecular formula C44H34N4O and a molecular weight of 634.78 g/mol. Its IUPAC name is (1Z,5Z,9Z,14Z)-20-cyclohexa-1,3-dien-1-yl-5,10,15-triphenyl-4,21,22,24-tetrahydroporphyrin-2-ol.
| Compound Name | (1Z,5Z,9Z,14Z)-20-cyclohexa-1,3-dien-1-yl-5,10,15-triphenyl-4,21,22,24-tetrahydroporphyrin-2-ol |
|---|---|
| PubChem CID | 154526848 |
| Molecular Formula | C44H34N4O |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | (1Z,5Z,9Z,14Z)-20-cyclohexa-1,3-dien-1-yl-5,10,15-triphenyl-4,21,22,24-tetrahydroporphyrin-2-ol |
| SMILES | OC1=CC2N/C1=C(/C1=CC=CCC1)c1ccc([nH]1)/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C44H34N4O/c49-39-27-38-42(30-17-9-3-10-18-30)36-24-23-34(46-36)40(28-13-5-1-6-14-28)32-21-22-33(45-32)41(29-15-7-2-8-16-29)35-25-26-37(47-35)43(44(39)48-38)31-19-11-4-12-20-31/h1-11,13-19,21-27,38,46-49H,12,20H2/b40-34-,41-33-,42-36-,44-43- |
| InChIKey | QJXWXPFKNKIFPQ-ALFPSKSFSA-N |
| XLogP | 7.63 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |