C44H34N4 — CID 75210756
5,10,15,20-tetraphenyl-1,14,21,22,23,24-hexahydroporphyrin (PubChem CID 75210756) has the molecular formula C44H34N4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-1,14,21,22,23,24-hexahydroporphyrin.
| Compound Name | 5,10,15,20-tetraphenyl-1,14,21,22,23,24-hexahydroporphyrin |
|---|---|
| PubChem CID | 75210756 |
| Molecular Formula | C44H34N4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 5,10,15,20-tetraphenyl-1,14,21,22,23,24-hexahydroporphyrin |
| SMILES | C1=CC2NC1=C(c1ccccc1)c1ccc([nH]1)C(c1ccccc1)=C1C=CC(N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1 |
| InChI | InChI=1S/C44H34N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,33,38,45-48H |
| InChIKey | BEBXMOKZXSNYSO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |