C54H41N5O — CID 136642661
N-methyl-4-[(E)-2-[(1Z,4Z,9Z,15Z)-5,10,15,20-tetraphenyl-19,21,23,24-tetrahydroporphyrin-2-yl]ethenyl]benzamide (PubChem CID 136642661) has the molecular formula C54H41N5O and a molecular weight of 775.96 g/mol. Its IUPAC name is N-methyl-4-[(E)-2-[(1Z,4Z,9Z,15Z)-5,10,15,20-tetraphenyl-19,21,23,24-tetrahydroporphyrin-2-yl]ethenyl]benzamide.
| Compound Name | N-methyl-4-[(E)-2-[(1Z,4Z,9Z,15Z)-5,10,15,20-tetraphenyl-19,21,23,24-tetrahydroporphyrin-2-yl]ethenyl]benzamide |
|---|---|
| PubChem CID | 136642661 |
| Molecular Formula | C54H41N5O |
| Molecular Weight | 775.96 g/mol |
| Exact Mass | 775.33 |
| IUPAC Name | N-methyl-4-[(E)-2-[(1Z,4Z,9Z,15Z)-5,10,15,20-tetraphenyl-19,21,23,24-tetrahydroporphyrin-2-yl]ethenyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/c2c/c3[nH]/c2=C(/c2ccccc2)C2C=C/C(=C(\c4ccccc4)c4ccc([nH]4)/C(c4ccccc4)=C4/C=CC(=N4)/C=3c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C54H41N5O/c1-55-54(60)40-25-22-35(23-26-40)24-27-41-34-48-51(38-18-10-4-11-19-38)46-31-30-44(57-46)49(36-14-6-2-7-15-36)42-28-29-43(56-42)50(37-16-8-3-9-17-37)45-32-33-47(58-45)52(53(41)59-48)39-20-12-5-13-21-39/h2-34,47,56,58-59H,1H3,(H,55,60)/b27-24+,49-44-,50-45-,51-48-,53-52- |
| InChIKey | YQQQGLSLIFHXPO-CLYSCWNVSA-N |
| XLogP | 9.04 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.96 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |