C50H36N4 — CID 135534838
5,10,15,20,22-pentakis-phenyl-21,23-dihydro-5H-porphyrin (PubChem CID 135534838) has the molecular formula C50H36N4 and a molecular weight of 692.87 g/mol. Its IUPAC name is 5,10,15,20,22-pentakis-phenyl-21,23-dihydro-5H-porphyrin.
| Compound Name | 5,10,15,20,22-pentakis-phenyl-21,23-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 135534838 |
| Molecular Formula | C50H36N4 |
| Molecular Weight | 692.87 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | 5,10,15,20,22-pentakis-phenyl-21,23-dihydro-5H-porphyrin |
| SMILES | C1=CC2=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)c3ccc(n3-c3ccccc3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)C1=N2 |
| InChI | InChI=1S/C50H36N4/c1-6-16-34(17-7-1)47-39-26-27-40(51-39)48(35-18-8-2-9-19-35)42-29-31-44(53-42)50(37-22-12-4-13-23-37)46-33-32-45(54(46)38-24-14-5-15-25-38)49(36-20-10-3-11-21-36)43-30-28-41(47)52-43/h1-33,49,52-53H |
| InChIKey | YIAZTLOCOLNMKP-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.87 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |