C44H28N4 — CID 135475814
4,9,14,19-tetraphenyl-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene (PubChem CID 135475814) has the molecular formula C44H28N4 and a molecular weight of 612.74 g/mol. Its IUPAC name is 4,9,14,19-tetraphenyl-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene.
| Compound Name | 4,9,14,19-tetraphenyl-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene |
|---|---|
| PubChem CID | 135475814 |
| Molecular Formula | C44H28N4 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 4,9,14,19-tetraphenyl-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene |
| SMILES | C1=C/C2=C(\c3ccccc3)c3ccc4c(-c5ccccc5)c5c(n34)=NC(=C5)/C(c3ccccc3)=c3/cc/c([nH]3)=C(\c3ccccc3)C1=N2 |
| InChI | InChI=1S/C44H28N4/c1-5-13-28(14-6-1)40-32-27-37-42(30-17-9-3-10-18-30)35-22-21-33(45-35)41(29-15-7-2-8-16-29)34-23-24-36(46-34)43(31-19-11-4-12-20-31)39-26-25-38(40)48(39)44(32)47-37/h1-27,45H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-39- |
| InChIKey | XXMOCCDRUGZTQR-HUJPYCGHSA-N |
| XLogP | 7.51 |
| TPSA | 44.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |