C39H26BN3 — CID 102229139
5,10,16,18-tetraphenyl-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene (PubChem CID 102229139) has the molecular formula C39H26BN3 and a molecular weight of 547.47 g/mol. Its IUPAC name is 5,10,16,18-tetraphenyl-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene.
| Compound Name | 5,10,16,18-tetraphenyl-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene |
|---|---|
| PubChem CID | 102229139 |
| Molecular Formula | C39H26BN3 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 5,10,16,18-tetraphenyl-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene |
| SMILES | C1=C/C2=C(\c3ccccc3)c3ccc4n3B(c3ccccc3)n3c(cc/c3=C(\c3ccccc3)C1=N2)=C4c1ccccc1 |
| InChI | InChI=1S/C39H26BN3/c1-5-13-27(14-6-1)37-31-21-22-32(41-31)38(28-15-7-2-8-16-28)34-24-26-36-39(29-17-9-3-10-18-29)35-25-23-33(37)42(35)40(43(34)36)30-19-11-4-12-20-30/h1-26H/b37-31-,37-33-,38-32-,38-34- |
| InChIKey | CMDZRKHVXXFIQG-MQECTDSJSA-N |
| XLogP | 5.62 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|