C70H48BN3O — CID 50993335
16-methoxy-5,10,18-tris[4-(4-phenylphenyl)phenyl]-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene (PubChem CID 50993335) has the molecular formula C70H48BN3O and a molecular weight of 957.99 g/mol. Its IUPAC name is 16-methoxy-5,10,18-tris[4-(4-phenylphenyl)phenyl]-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene.
| Compound Name | 16-methoxy-5,10,18-tris[4-(4-phenylphenyl)phenyl]-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene |
|---|---|
| PubChem CID | 50993335 |
| Molecular Formula | C70H48BN3O |
| Molecular Weight | 957.99 g/mol |
| Exact Mass | 957.39 |
| IUPAC Name | 16-methoxy-5,10,18-tris[4-(4-phenylphenyl)phenyl]-15,17,19-triaza-16-borapentacyclo[12.3.1.16,9.04,17.011,15]nonadeca-1(18),2,4,6(19),7,9,11,13-octaene |
| SMILES | COB1n2c3ccc2/C(c2ccc(-c4ccc(-c5ccccc5)cc4)cc2)=C2/C=CC(=N2)/C(c2ccc(-c4ccc(-c5ccccc5)cc4)cc2)=c2/ccc(n21)=C3c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C70H48BN3O/c1-75-71-73-64-43-45-66(73)70(61-39-33-58(34-40-61)55-27-21-52(22-28-55)49-15-9-4-10-16-49)67-46-44-65(74(67)71)69(60-37-31-57(32-38-60)54-25-19-51(20-26-54)48-13-7-3-8-14-48)63-42-41-62(72-63)68(64)59-35-29-56(30-36-59)53-23-17-50(18-24-53)47-11-5-2-6-12-47/h2-46H,1H3/b68-62-,68-64-,69-63-,69-65- |
| InChIKey | AEUJNLUEIDZFMW-LCEAAGAUSA-N |
| XLogP | 14.86 |
| TPSA | 31.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.99 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|