C52H32N4O2 — CID 135746572
3-(10,15,20-triphenylporphyrin-5-yl)phenanthrene-9,10-diol (PubChem CID 135746572) has the molecular formula C52H32N4O2 and a molecular weight of 744.85 g/mol. Its IUPAC name is 3-(10,15,20-triphenylporphyrin-5-yl)phenanthrene-9,10-diol.
| Compound Name | 3-(10,15,20-triphenylporphyrin-5-yl)phenanthrene-9,10-diol |
|---|---|
| PubChem CID | 135746572 |
| Molecular Formula | C52H32N4O2 |
| Molecular Weight | 744.85 g/mol |
| Exact Mass | 744.25 |
| IUPAC Name | 3-(10,15,20-triphenylporphyrin-5-yl)phenanthrene-9,10-diol |
| SMILES | Oc1c(O)c2ccc(/C3=C4\C=CC(=N4)/C(c4ccccc4)=C4/C=CC(=N4)/C(c4ccccc4)=C4/C=CC(=N4)/C(c4ccccc4)=C4/C=CC3=N4)cc2c2ccccc12 |
| InChI | InChI=1S/C52H32N4O2/c57-51-36-19-11-10-18-35(36)38-30-34(20-21-37(38)52(51)58)50-45-28-26-43(55-45)48(32-14-6-2-7-15-32)41-24-22-39(53-41)47(31-12-4-1-5-13-31)40-23-25-42(54-40)49(33-16-8-3-9-17-33)44-27-29-46(50)56-44/h1-30,57-58H/b47-39-,47-40-,48-41-,48-43-,49-42-,49-44-,50-45-,50-46- |
| InChIKey | MHUKZJGBQMCAJI-VZQFQVGISA-N |
| XLogP | 11.41 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.85 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|