C40H26O4 — CID 88935473
2-[4-[4-(9,10-dihydroxyphenanthren-2-yl)phenyl]phenyl]phenanthrene-9,10-diol (PubChem CID 88935473) has the molecular formula C40H26O4 and a molecular weight of 570.64 g/mol. Its IUPAC name is 2-[4-[4-(9,10-dihydroxyphenanthren-2-yl)phenyl]phenyl]phenanthrene-9,10-diol.
| Compound Name | 2-[4-[4-(9,10-dihydroxyphenanthren-2-yl)phenyl]phenyl]phenanthrene-9,10-diol |
|---|---|
| PubChem CID | 88935473 |
| Molecular Formula | C40H26O4 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 2-[4-[4-(9,10-dihydroxyphenanthren-2-yl)phenyl]phenyl]phenanthrene-9,10-diol |
| SMILES | Oc1c(O)c2cc(-c3ccc(-c4ccc(-c5ccc6c(c5)c(O)c(O)c5ccccc56)cc4)cc3)ccc2c2ccccc12 |
| InChI | InChI=1S/C40H26O4/c41-37-33-7-3-1-5-29(33)31-19-17-27(21-35(31)39(37)43)25-13-9-23(10-14-25)24-11-15-26(16-12-24)28-18-20-32-30-6-2-4-8-34(30)38(42)40(44)36(32)22-28/h1-22,41-44H |
| InChIKey | YOGYIHOVUXNNBW-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|