C48H33NO18 — CID 144999368
6-[2,3,5,6-tetrahydroxy-4-(N-[2,3,5,6-tetrahydroxy-4-(2,3,4,5,6-pentahydroxyphenyl)phenyl]-4-triphenylen-2-ylanilino)phenyl]benzene-1,2,3,4,5-pentol (PubChem CID 144999368) has the molecular formula C48H33NO18 and a molecular weight of 911.78 g/mol. Its IUPAC name is 6-[2,3,5,6-tetrahydroxy-4-(N-[2,3,5,6-tetrahydroxy-4-(2,3,4,5,6-pentahydroxyphenyl)phenyl]-4-triphenylen-2-ylanilino)phenyl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[2,3,5,6-tetrahydroxy-4-(N-[2,3,5,6-tetrahydroxy-4-(2,3,4,5,6-pentahydroxyphenyl)phenyl]-4-triphenylen-2-ylanilino)phenyl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 144999368 |
| Molecular Formula | C48H33NO18 |
| Molecular Weight | 911.78 g/mol |
| Exact Mass | 911.17 |
| IUPAC Name | 6-[2,3,5,6-tetrahydroxy-4-(N-[2,3,5,6-tetrahydroxy-4-(2,3,4,5,6-pentahydroxyphenyl)phenyl]-4-triphenylen-2-ylanilino)phenyl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c(O)c(O)c(N(c3ccc(-c4ccc5c6ccccc6c6ccccc6c5c4)cc3)c3c(O)c(O)c(-c4c(O)c(O)c(O)c(O)c4O)c(O)c3O)c(O)c2O)c(O)c1O |
| InChI | InChI=1S/C48H33NO18/c50-31-25(27-35(54)43(62)47(66)44(63)36(27)55)32(51)40(59)29(39(31)58)49(30-41(60)33(52)26(34(53)42(30)61)28-37(56)45(64)48(67)46(65)38(28)57)18-12-9-16(10-13-18)17-11-14-23-21-7-2-1-5-19(21)20-6-3-4-8-22(20)24(23)15-17/h1-15,50-67H |
| InChIKey | NBBYCRGZQCAGOK-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 367.38 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.78 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|