C44H30N6 — CID 175303867
3-[15-(3-aminophenyl)-10,20-diphenylporphyrin-5-yl]aniline (PubChem CID 175303867) has the molecular formula C44H30N6 and a molecular weight of 642.77 g/mol. Its IUPAC name is 3-[15-(3-aminophenyl)-10,20-diphenylporphyrin-5-yl]aniline.
| Compound Name | 3-[15-(3-aminophenyl)-10,20-diphenylporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 175303867 |
| Molecular Formula | C44H30N6 |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 3-[15-(3-aminophenyl)-10,20-diphenylporphyrin-5-yl]aniline |
| SMILES | Nc1cccc(/C2=C3\C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3cccc(N)c3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC2=N3)c1 |
| InChI | InChI=1S/C44H30N6/c45-31-15-7-13-29(25-31)43-37-21-17-33(47-37)41(27-9-3-1-4-10-27)34-18-22-38(48-34)44(30-14-8-16-32(46)26-30)40-24-20-36(50-40)42(28-11-5-2-6-12-28)35-19-23-39(43)49-35/h1-26H,45-46H2/b41-33-,41-34-,42-35-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | BFXYKTGUJMIADJ-VRDUDMDPSA-N |
| XLogP | 8.85 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|