C38H25N5 — CID 174699441
4-(15,20-diphenylporphyrin-2-yl)aniline (PubChem CID 174699441) has the molecular formula C38H25N5 and a molecular weight of 551.65 g/mol. Its IUPAC name is 4-(15,20-diphenylporphyrin-2-yl)aniline.
| Compound Name | 4-(15,20-diphenylporphyrin-2-yl)aniline |
|---|---|
| PubChem CID | 174699441 |
| Molecular Formula | C38H25N5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 4-(15,20-diphenylporphyrin-2-yl)aniline |
| SMILES | Nc1ccc(C2=C/C3=C/C4=N/C(=C\C5=N/C(=C(/c6ccccc6)C6=N/C(=C(/c7ccccc7)C2=N3)C=C6)C=C5)C=C4)cc1 |
| InChI | InChI=1S/C38H25N5/c39-27-13-11-24(12-14-27)32-23-31-22-29-16-15-28(40-29)21-30-17-18-33(41-30)36(25-7-3-1-4-8-25)34-19-20-35(43-34)37(38(32)42-31)26-9-5-2-6-10-26/h1-23H,39H2/b28-21-,29-22-,30-21-,31-22-,36-33-,36-34-,37-35-,38-37- |
| InChIKey | UNPNNLDGMGHXHD-DOFDRCBOSA-N |
| XLogP | 7.74 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|