C45H29ClN4 — CID 174861119
2-[4-(chloromethyl)phenyl]-10,15,20-triphenylporphyrin (PubChem CID 174861119) has the molecular formula C45H29ClN4 and a molecular weight of 661.21 g/mol. Its IUPAC name is 2-[4-(chloromethyl)phenyl]-10,15,20-triphenylporphyrin.
| Compound Name | 2-[4-(chloromethyl)phenyl]-10,15,20-triphenylporphyrin |
|---|---|
| PubChem CID | 174861119 |
| Molecular Formula | C45H29ClN4 |
| Molecular Weight | 661.21 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | 2-[4-(chloromethyl)phenyl]-10,15,20-triphenylporphyrin |
| SMILES | ClCc1ccc(C2=CC3=N/C2=C(/c2ccccc2)C2=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C\3)C=C5)C=C4)C=C2)cc1 |
| InChI | InChI=1S/C45H29ClN4/c46-28-29-16-18-30(19-17-29)36-27-35-26-34-20-21-37(47-34)42(31-10-4-1-5-11-31)38-22-23-39(49-38)43(32-12-6-2-7-13-32)40-24-25-41(50-40)44(45(36)48-35)33-14-8-3-9-15-33/h1-27H,28H2/b34-26-,35-26-,42-37-,42-38-,43-39-,43-40-,44-41-,45-44- |
| InChIKey | MPHSLNQTSCMFQF-VVKQFSPQSA-N |
| XLogP | 10.43 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.21 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|