C45H27F3N4 — CID 175231803
2,3,5,7-tetraphenyl-8-(trifluoromethyl)porphyrin (PubChem CID 175231803) has the molecular formula C45H27F3N4 and a molecular weight of 680.73 g/mol. Its IUPAC name is 2,3,5,7-tetraphenyl-8-(trifluoromethyl)porphyrin.
| Compound Name | 2,3,5,7-tetraphenyl-8-(trifluoromethyl)porphyrin |
|---|---|
| PubChem CID | 175231803 |
| Molecular Formula | C45H27F3N4 |
| Molecular Weight | 680.73 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | 2,3,5,7-tetraphenyl-8-(trifluoromethyl)porphyrin |
| SMILES | FC(F)(F)C1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C45H27F3N4/c46-45(47,48)42-37-27-35-24-22-33(50-35)25-32-21-23-34(49-32)26-36-38(28-13-5-1-6-14-28)39(29-15-7-2-8-16-29)43(51-36)41(31-19-11-4-12-20-31)44(52-37)40(42)30-17-9-3-10-18-30/h1-27H/b32-25-,33-25-,34-26-,35-27-,36-26-,37-27-,43-41-,44-41- |
| InChIKey | UYSYJNIRQPROTH-UGNYBRDPSA-N |
| XLogP | 10.62 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.73 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|