About 2-phenylporphyrin
2-phenylporphyrin (PubChem CID 66696851) has the molecular formula C26H16N4
and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-phenylporphyrin.
Molecular Properties
| Compound Name | 2-phenylporphyrin |
| PubChem CID | 66696851 |
| Molecular Formula | C26H16N4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-phenylporphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C(c1ccccc1)=C4)C=C3 |
| InChI | InChI=1S/C26H16N4/c1-2-4-17(5-3-1)25-15-24-14-22-9-8-20(28-22)12-18-6-7-19(27-18)13-21-10-11-23(29-21)16-26(25)30-24/h1-16H/b18-12-,19-13-,20-12-,21-13-,22-14-,23-16-,24-14-,26-16- |
| InChIKey | XZTGDQOXDUIKAB-QACVNNBASA-N |
| XLogP | 5.11 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylporphyrin?
The IUPAC name of 2-phenylporphyrin (CID 66696851) is 2-phenylporphyrin.
What is the SMILES notation for 2-phenylporphyrin?
The canonical SMILES for 2-phenylporphyrin is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C(c1ccccc1)=C4)C=C3.
What is the InChIKey of 2-phenylporphyrin?
The InChIKey is XZTGDQOXDUIKAB-QACVNNBASA-N. The full InChI is InChI=1S/C26H16N4/c1-2-4-17(5-3-1)25-15-24-14-22-9-8-20(28-22)12-18-6-7-19(27-18)13-21-10-11-23(29-21)16-26(25)30-24/h1-16H/b18-12-,19-13-,20-12-,21-13-,22-14-,23-16-,24-14-,26-16-.
What are the key properties of 2-phenylporphyrin?
2-phenylporphyrin has a molecular weight of 384.44 g/mol, XLogP of 5.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylporphyrin is sourced from PubChem (CID 66696851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).