C34H32N4O — CID 174864440
2-(2-octoxyphenyl)porphyrin (PubChem CID 174864440) has the molecular formula C34H32N4O and a molecular weight of 512.66 g/mol. Its IUPAC name is 2-(2-octoxyphenyl)porphyrin.
| Compound Name | 2-(2-octoxyphenyl)porphyrin |
|---|---|
| PubChem CID | 174864440 |
| Molecular Formula | C34H32N4O |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 2-(2-octoxyphenyl)porphyrin |
| SMILES | CCCCCCCCOc1ccccc1C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C34H32N4O/c1-2-3-4-5-6-9-18-39-34-11-8-7-10-31(34)32-22-30-21-28-15-14-26(36-28)19-24-12-13-25(35-24)20-27-16-17-29(37-27)23-33(32)38-30/h7-8,10-17,19-23H,2-6,9,18H2,1H3/b24-19-,25-20-,26-19-,27-20-,28-21-,29-23-,30-21-,33-23- |
| InChIKey | XYLRAVJXBOPRNS-RJNDMFNQSA-N |
| XLogP | 7.85 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|