C38H38Br2N4O2 — CID 175510455
10,20-dibromo-2-(2,6-dihexoxyphenyl)porphyrin (PubChem CID 175510455) has the molecular formula C38H38Br2N4O2 and a molecular weight of 742.56 g/mol. Its IUPAC name is 10,20-dibromo-2-(2,6-dihexoxyphenyl)porphyrin.
| Compound Name | 10,20-dibromo-2-(2,6-dihexoxyphenyl)porphyrin |
|---|---|
| PubChem CID | 175510455 |
| Molecular Formula | C38H38Br2N4O2 |
| Molecular Weight | 742.56 g/mol |
| Exact Mass | 740.14 |
| IUPAC Name | 10,20-dibromo-2-(2,6-dihexoxyphenyl)porphyrin |
| SMILES | CCCCCCOc1cccc(OCCCCCC)c1C1=C/C2=C/C3=N/C(=C(/Br)C4=N/C(=C\C5=N/C(=C(/Br)C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C38H38Br2N4O2/c1-3-5-7-9-20-45-33-12-11-13-34(46-21-10-8-6-4-2)35(33)29-24-28-23-27-15-18-31(42-27)36(39)30-17-14-25(41-30)22-26-16-19-32(43-26)37(40)38(29)44-28/h11-19,22-24H,3-10,20-21H2,1-2H3/b25-22-,26-22-,27-23-,28-23-,36-30+,36-31+,37-32+,38-37+ |
| InChIKey | RYAXECOLVRTFLD-OPXGKEPYSA-N |
| XLogP | 10.47 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.56 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|