C70H76N4 — CID 89306548
5,15-bis(9,9-dihexylfluoren-1-yl)porphyrin (PubChem CID 89306548) has the molecular formula C70H76N4 and a molecular weight of 973.41 g/mol. Its IUPAC name is 5,15-bis(9,9-dihexylfluoren-1-yl)porphyrin.
| Compound Name | 5,15-bis(9,9-dihexylfluoren-1-yl)porphyrin |
|---|---|
| PubChem CID | 89306548 |
| Molecular Formula | C70H76N4 |
| Molecular Weight | 973.41 g/mol |
| Exact Mass | 972.61 |
| IUPAC Name | 5,15-bis(9,9-dihexylfluoren-1-yl)porphyrin |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2cccc(/C3=C4\C=CC(=N4)/C=C4/C=CC(=N4)/C(c4cccc5c4C(CCCCCC)(CCCCCC)c4ccccc4-5)=C4/C=CC(=N4)/C=C4/C=CC3=N4)c21 |
| InChI | InChI=1S/C70H76N4/c1-5-9-13-21-43-69(44-22-14-10-6-2)59-33-19-17-27-53(59)55-29-25-31-57(67(55)69)65-61-39-35-49(71-61)47-51-37-41-63(73-51)66(64-42-38-52(74-64)48-50-36-40-62(65)72-50)58-32-26-30-56-54-28-18-20-34-60(54)70(68(56)58,45-23-15-11-7-3)46-24-16-12-8-4/h17-20,25-42,47-48H,5-16,21-24,43-46H2,1-4H3/b49-47-,50-48-,51-47-,52-48-,65-61-,65-62-,66-63-,66-64- |
| InChIKey | XSUMIWCCIRBHGF-VCNNLJSASA-N |
| XLogP | 19.05 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.41 |
| LogP ≤ 5 | 19.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|