C44H29N5 — CID 174699434
4-(10,15,20-triphenylporphyrin-2-yl)aniline (PubChem CID 174699434) has the molecular formula C44H29N5 and a molecular weight of 627.75 g/mol. Its IUPAC name is 4-(10,15,20-triphenylporphyrin-2-yl)aniline.
| Compound Name | 4-(10,15,20-triphenylporphyrin-2-yl)aniline |
|---|---|
| PubChem CID | 174699434 |
| Molecular Formula | C44H29N5 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 4-(10,15,20-triphenylporphyrin-2-yl)aniline |
| SMILES | Nc1ccc(C2=CC3=N/C2=C(/c2ccccc2)C2=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C\3)C=C5)C=C4)C=C2)cc1 |
| InChI | InChI=1S/C44H29N5/c45-32-18-16-28(17-19-32)35-27-34-26-33-20-21-36(46-33)41(29-10-4-1-5-11-29)37-22-23-38(48-37)42(30-12-6-2-7-13-30)39-24-25-40(49-39)43(44(35)47-34)31-14-8-3-9-15-31/h1-27H,45H2/b33-26-,34-26-,41-36-,41-37-,42-38-,42-39-,43-40-,44-43- |
| InChIKey | QBJKHYHTRTUQSJ-DLLKQJABSA-N |
| XLogP | 9.27 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|