C44H27CuN5O2 — CID 174636839
copper;2-nitro-5,10,15,20-tetraphenylporphyrin (PubChem CID 174636839) has the molecular formula C44H27CuN5O2 and a molecular weight of 721.28 g/mol. Its IUPAC name is copper;2-nitro-5,10,15,20-tetraphenylporphyrin.
| Compound Name | copper;2-nitro-5,10,15,20-tetraphenylporphyrin |
|---|---|
| PubChem CID | 174636839 |
| Molecular Formula | C44H27CuN5O2 |
| Molecular Weight | 721.28 g/mol |
| Exact Mass | 720.15 |
| IUPAC Name | copper;2-nitro-5,10,15,20-tetraphenylporphyrin |
| SMILES | O=[N+]([O-])C1=CC2=N/C1=C(/c1ccccc1)C1=N/C(=C(/c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N\C(=C/2c2ccccc2)C=C4)C=C3)C=C1.[Cu] |
| InChI | InChI=1S/C44H27N5O2.Cu/c50-49(51)39-27-38-42(30-17-9-3-10-18-30)36-24-23-34(46-36)40(28-13-5-1-6-14-28)32-21-22-33(45-32)41(29-15-7-2-8-16-29)35-25-26-37(47-35)43(44(39)48-38)31-19-11-4-12-20-31;/h1-27H;/b40-32-,40-34-,41-33-,41-35-,42-36-,42-38-,43-37-,44-43-; |
| InChIKey | XMAJSCSWQADWDX-SHKHMHAWSA-N |
| XLogP | 9.29 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.28 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|