C53H38N5O+ — CID 137147525
(E)-1-(1-methyl-2-pyridinylidene)-3-(5,10,15,20-tetraphenylporphyrin-23-ium-2-yl)prop-2-en-1-ol (PubChem CID 137147525) has the molecular formula C53H38N5O+ and a molecular weight of 760.92 g/mol. Its IUPAC name is (E)-1-(1-methyl-2-pyridinylidene)-3-(5,10,15,20-tetraphenylporphyrin-23-ium-2-yl)prop-2-en-1-ol.
| Compound Name | (E)-1-(1-methyl-2-pyridinylidene)-3-(5,10,15,20-tetraphenylporphyrin-23-ium-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 137147525 |
| Molecular Formula | C53H38N5O+ |
| Molecular Weight | 760.92 g/mol |
| Exact Mass | 760.31 |
| IUPAC Name | (E)-1-(1-methyl-2-pyridinylidene)-3-(5,10,15,20-tetraphenylporphyrin-23-ium-2-yl)prop-2-en-1-ol |
| SMILES | CN1C=CC=CC1=C(O)/C=C/C1=CC2=N/C1=C(/c1ccccc1)C1=N/C(=C(/c3ccccc3)C3=[NH+]/C(=C(/c4ccccc4)C4=N/C(=C\2c2ccccc2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C53H37N5O/c1-58-33-15-14-24-47(58)48(59)32-25-39-34-46-51(37-20-10-4-11-21-37)44-29-28-42(55-44)49(35-16-6-2-7-17-35)40-26-27-41(54-40)50(36-18-8-3-9-19-36)43-30-31-45(56-43)52(53(39)57-46)38-22-12-5-13-23-38/h2-34,59H,1H3/p+1/b32-25+,48-47?,49-40-,49-42-,50-41-,50-43-,51-44-,51-46-,52-45-,53-52- |
| InChIKey | QVXMBRXZPIOZSP-DZWAZNSSSA-O |
| XLogP | 9.48 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.92 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|