C54H36N4O4 — CID 158249467
4-[(E)-2-(5,10,15,20-tetraphenyl-10,23-dihydroporphyrin-2-yl)ethenyl]phthalic acid (PubChem CID 158249467) has the molecular formula C54H36N4O4 and a molecular weight of 804.91 g/mol. Its IUPAC name is 4-[(E)-2-(5,10,15,20-tetraphenyl-10,23-dihydroporphyrin-2-yl)ethenyl]phthalic acid.
| Compound Name | 4-[(E)-2-(5,10,15,20-tetraphenyl-10,23-dihydroporphyrin-2-yl)ethenyl]phthalic acid |
|---|---|
| PubChem CID | 158249467 |
| Molecular Formula | C54H36N4O4 |
| Molecular Weight | 804.91 g/mol |
| Exact Mass | 804.27 |
| IUPAC Name | 4-[(E)-2-(5,10,15,20-tetraphenyl-10,23-dihydroporphyrin-2-yl)ethenyl]phthalic acid |
| SMILES | O=C(O)c1ccc(/C=C/C2=CC3=NC2=C(c2ccccc2)C2=NC(=C(c4ccccc4)c4ccc([nH]4)C(c4ccccc4)C4=NC(=C3c3ccccc3)C=C4)C=C2)cc1C(=O)O |
| InChI | InChI=1S/C54H36N4O4/c59-53(60)39-24-22-33(31-40(39)54(61)62)21-23-38-32-47-50(36-17-9-3-10-18-36)45-28-27-43(56-45)48(34-13-5-1-6-14-34)41-25-26-42(55-41)49(35-15-7-2-8-16-35)44-29-30-46(57-44)51(52(38)58-47)37-19-11-4-12-20-37/h1-32,48,55H,(H,59,60)(H,61,62)/b23-21+,49-44?,50-45?,52-51? |
| InChIKey | CTAJFYOUBMNXBI-MVKUDCOJSA-N |
| XLogP | 11.25 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.91 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |