C45H34N4 — CID 136806099
(5R,10Z,14Z,19Z)-22-methyl-5,10,15,20-tetraphenyl-21,23-dihydro-5H-porphyrin (PubChem CID 136806099) has the molecular formula C45H34N4 and a molecular weight of 630.80 g/mol. Its IUPAC name is (5R,10Z,14Z,19Z)-22-methyl-5,10,15,20-tetraphenyl-21,23-dihydro-5H-porphyrin.
| Compound Name | (5R,10Z,14Z,19Z)-22-methyl-5,10,15,20-tetraphenyl-21,23-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 136806099 |
| Molecular Formula | C45H34N4 |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | (5R,10Z,14Z,19Z)-22-methyl-5,10,15,20-tetraphenyl-21,23-dihydro-5H-porphyrin |
| SMILES | Cn1c2ccc1[C@H](c1ccccc1)c1ccc([nH]1)/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C45H34N4/c1-49-40-28-29-41(49)45(33-20-12-5-13-21-33)39-27-25-37(48-39)43(31-16-8-3-9-17-31)35-23-22-34(46-35)42(30-14-6-2-7-15-30)36-24-26-38(47-36)44(40)32-18-10-4-11-19-32/h2-29,44,47-48H,1H3/b42-34-,43-37-,45-39-/t44-/m1/s1 |
| InChIKey | RGXRYIZPBNRCQN-DLXFEQKNSA-N |
| XLogP | 8.09 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |