C46H28N4NiO2 — CID 73209184
(12-formyl-5,10,15,20-tetraphenylporphyrin-24-id-2-ylidene)methanolate;nickel(2+) (PubChem CID 73209184) has the molecular formula C46H28N4NiO2 and a molecular weight of 727.45 g/mol. Its IUPAC name is (12-formyl-5,10,15,20-tetraphenylporphyrin-24-id-2-ylidene)methanolate;nickel(2+).
| Compound Name | (12-formyl-5,10,15,20-tetraphenylporphyrin-24-id-2-ylidene)methanolate;nickel(2+) |
|---|---|
| PubChem CID | 73209184 |
| Molecular Formula | C46H28N4NiO2 |
| Molecular Weight | 727.45 g/mol |
| Exact Mass | 726.16 |
| IUPAC Name | (12-formyl-5,10,15,20-tetraphenylporphyrin-24-id-2-ylidene)methanolate;nickel(2+) |
| SMILES | O=CC1=CC2=N/C1=C(/c1ccccc1)C1=N/C(=C(/c3ccccc3)C3=CC(=C[O-])C(=N3)/C(c3ccccc3)=c3/cc/c([n-]3)=C/2c2ccccc2)C=C1.[Ni+2] |
| InChI | InChI=1S/C46H30N4O2.Ni/c51-27-33-25-39-41(29-13-5-1-6-14-29)35-21-23-37(47-35)43(31-17-9-3-10-18-31)46-34(28-52)26-40(50-46)42(30-15-7-2-8-16-30)36-22-24-38(48-36)44(45(33)49-39)32-19-11-4-12-20-32;/h1-28H,(H2,47,48,49,50,51,52);/q;+2/p-2/b41-35-,41-39-,42-36-,42-40-,43-37-,44-38-,45-44-,46-43-; |
| InChIKey | DGVQSXRSGNYBAA-HMWFWNBOSA-L |
| XLogP | 6.05 |
| TPSA | 91.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|