C44H26N6NiO — CID 12000546
3-diazo-5,10,15,20-tetraphenylporphyrin-22-id-2-olate;nickel(2+) (PubChem CID 12000546) has the molecular formula C44H26N6NiO and a molecular weight of 713.43 g/mol. Its IUPAC name is 3-diazo-5,10,15,20-tetraphenylporphyrin-22-id-2-olate;nickel(2+).
| Compound Name | 3-diazo-5,10,15,20-tetraphenylporphyrin-22-id-2-olate;nickel(2+) |
|---|---|
| PubChem CID | 12000546 |
| Molecular Formula | C44H26N6NiO |
| Molecular Weight | 713.43 g/mol |
| Exact Mass | 712.15 |
| IUPAC Name | 3-diazo-5,10,15,20-tetraphenylporphyrin-22-id-2-olate;nickel(2+) |
| SMILES | [N-]=[N+]=C1C2=NC(=C1[O-])/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1/cc/c([n-]1)=C/2c1ccccc1.[Ni+2] |
| InChI | InChI=1S/C44H27N6O.Ni/c45-50-43-41-39(29-17-9-3-10-18-29)35-25-23-33(47-35)37(27-13-5-1-6-14-27)31-21-22-32(46-31)38(28-15-7-2-8-16-28)34-24-26-36(48-34)40(42(49-41)44(43)51)30-19-11-4-12-20-30;/h1-26H,(H-,46,47,48,49,51);/q-1;+2/p-1 |
| InChIKey | BCNJGBFHHRCBIW-UHFFFAOYSA-M |
| XLogP | 5.59 |
| TPSA | 110.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|