C44H28AlN4- — CID 159188888
CID 159188888 (PubChem CID 159188888) has the molecular formula C44H28AlN4- and a molecular weight of 639.72 g/mol.
| Compound Name | CID 159188888 |
|---|---|
| PubChem CID | 159188888 |
| Molecular Formula | C44H28AlN4- |
| Molecular Weight | 639.72 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | — |
| SMILES | C1=C/C2=C(\c3ccccc3)c3ccc4n3[Al-]n3/c(cc/c3=C(\c3ccccc3)C3=N/C(=C\4c4ccccc4)C=C3)=C(/c3ccccc3)C1=N2 |
| InChI | InChI=1S/C44H28N4.Al/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | KXHUSVASJIOFMK-DAJBKUBHSA-N |
| XLogP | 7.19 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |