C58H40N4 — CID 132502296
5,10,15,21,22,24-hexakis-phenyl-20,23,25,26-tetrazahexacyclo[17.4.1.16,9.111,14.04,23.016,20]hexacosa-1(24),2,4,6(26),7,9,11(25),12,14,16,18-undecaene (PubChem CID 132502296) has the molecular formula C58H40N4 and a molecular weight of 792.99 g/mol. Its IUPAC name is 5,10,15,21,22,24-hexakis-phenyl-20,23,25,26-tetrazahexacyclo[17.4.1.16,9.111,14.04,23.016,20]hexacosa-1(24),2,4,6(26),7,9,11(25),12,14,16,18-undecaene.
| Compound Name | 5,10,15,21,22,24-hexakis-phenyl-20,23,25,26-tetrazahexacyclo[17.4.1.16,9.111,14.04,23.016,20]hexacosa-1(24),2,4,6(26),7,9,11(25),12,14,16,18-undecaene |
|---|---|
| PubChem CID | 132502296 |
| Molecular Formula | C58H40N4 |
| Molecular Weight | 792.99 g/mol |
| Exact Mass | 792.33 |
| IUPAC Name | 5,10,15,21,22,24-hexakis-phenyl-20,23,25,26-tetrazahexacyclo[17.4.1.16,9.111,14.04,23.016,20]hexacosa-1(24),2,4,6(26),7,9,11(25),12,14,16,18-undecaene |
| SMILES | C1=C/C2=C(\c3ccccc3)c3ccc4n3C(c3ccccc3)C(c3ccccc3)n3c(cc/c3=C(\c3ccccc3)C3=N/C(=C(/c5ccccc5)C1=N2)C=C3)=C4c1ccccc1 |
| InChI | InChI=1S/C58H40N4/c1-7-19-39(20-8-1)53-45-31-33-47(59-45)54(40-21-9-2-10-22-40)49-35-37-51-56(42-25-13-4-14-26-42)52-38-36-50(55(41-23-11-3-12-24-41)48-34-32-46(53)60-48)62(52)58(44-29-17-6-18-30-44)57(61(49)51)43-27-15-5-16-28-43/h1-38,57-58H/b53-45-,53-46+,54-47-,54-49-,55-48+,55-50- |
| InChIKey | NHSBDPBNBWCCOQ-OCVFUWNUSA-N |
| XLogP | 11.13 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.99 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |