C48H35BrN4 — CID 136702399
22-bromo-4,9,14,19-tetrakis(4-methylphenyl)-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene (PubChem CID 136702399) has the molecular formula C48H35BrN4 and a molecular weight of 747.74 g/mol. Its IUPAC name is 22-bromo-4,9,14,19-tetrakis(4-methylphenyl)-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene.
| Compound Name | 22-bromo-4,9,14,19-tetrakis(4-methylphenyl)-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene |
|---|---|
| PubChem CID | 136702399 |
| Molecular Formula | C48H35BrN4 |
| Molecular Weight | 747.74 g/mol |
| Exact Mass | 746.20 |
| IUPAC Name | 22-bromo-4,9,14,19-tetrakis(4-methylphenyl)-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1,3(22),4,6,8,10(23),11,13,15,17,19-undecaene |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C)cc3)C3=C(Br)c4c(-c5ccc(C)cc5)c5ccc2n5c4=N3)cc1 |
| InChI | InChI=1S/C48H35BrN4/c1-27-5-13-31(14-6-27)41-35-21-23-37(50-35)42(32-15-7-28(2)8-16-32)39-25-26-40-44(34-19-11-30(4)12-20-34)45-46(49)47(52-48(45)53(39)40)43(38-24-22-36(41)51-38)33-17-9-29(3)10-18-33/h5-26,51H,1-4H3/b41-35-,41-36-,42-37-,42-39-,43-38-,47-43- |
| InChIKey | GBIPSTMFSDHBBG-JUCBDZCESA-N |
| XLogP | 9.47 |
| TPSA | 44.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.74 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |