C50H40N4O2 — CID 136721400
methyl 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carboxylate (PubChem CID 136721400) has the molecular formula C50H40N4O2 and a molecular weight of 728.90 g/mol. Its IUPAC name is methyl 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carboxylate.
| Compound Name | methyl 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carboxylate |
|---|---|
| PubChem CID | 136721400 |
| Molecular Formula | C50H40N4O2 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | methyl 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carboxylate |
| SMILES | COC(=O)C1C2=CN=C1/C(c1ccc(C)cc1)=C1/C=CC(=N1)/C(c1ccc(C)cc1)=c1/cc/c([nH]1)=C(\c1ccc(C)cc1)C1=N/C(=C\2c2ccc(C)cc2)C=C1 |
| InChI | InChI=1S/C50H40N4O2/c1-29-6-14-33(15-7-29)44-37-28-51-49(48(37)50(55)56-5)47(36-20-12-32(4)13-21-36)43-27-26-42(54-43)46(35-18-10-31(3)11-19-35)41-25-24-40(53-41)45(39-23-22-38(44)52-39)34-16-8-30(2)9-17-34/h6-28,48,53H,1-5H3/b44-37-,44-38-,45-39-,45-40-,46-41-,46-42-,47-43-,49-47+ |
| InChIKey | RPPJKAZJQOCJTI-XGWDBDIISA-N |
| XLogP | 8.63 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |