C39H28N2O2 — CID 177447919
(7Z,12Z,16Z)-12,17-bis(4-methylphenyl)-7-phenyl-4,21-dioxa-22,23-diazapentacyclo[16.2.1.18,11.113,16.02,6]tricosa-1(20),2,5,7,9,11(23),12,14,16,18-decaene (PubChem CID 177447919) has the molecular formula C39H28N2O2 and a molecular weight of 556.67 g/mol. Its IUPAC name is (7Z,12Z,16Z)-12,17-bis(4-methylphenyl)-7-phenyl-4,21-dioxa-22,23-diazapentacyclo[16.2.1.18,11.113,16.02,6]tricosa-1(20),2,5,7,9,11(23),12,14,16,18-decaene.
| Compound Name | (7Z,12Z,16Z)-12,17-bis(4-methylphenyl)-7-phenyl-4,21-dioxa-22,23-diazapentacyclo[16.2.1.18,11.113,16.02,6]tricosa-1(20),2,5,7,9,11(23),12,14,16,18-decaene |
|---|---|
| PubChem CID | 177447919 |
| Molecular Formula | C39H28N2O2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | (7Z,12Z,16Z)-12,17-bis(4-methylphenyl)-7-phenyl-4,21-dioxa-22,23-diazapentacyclo[16.2.1.18,11.113,16.02,6]tricosa-1(20),2,5,7,9,11(23),12,14,16,18-decaene |
| SMILES | Cc1ccc(/C2=c3\cc/c([nH]3)=C(\c3ccc(C)cc3)c3ccc(o3)-c3cocc3/C(c3ccccc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C39H28N2O2/c1-24-8-12-27(13-9-24)38-32-17-16-31(40-32)37(26-6-4-3-5-7-26)30-23-42-22-29(30)35-20-21-36(43-35)39(34-19-18-33(38)41-34)28-14-10-25(2)11-15-28/h3-23,41H,1-2H3/b37-31-,38-33-,39-34- |
| InChIKey | UWGILARGSSKMCJ-LRVYWNRBSA-N |
| XLogP | 7.71 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |