C48H33Cl2N3O2 — CID 135627657
7,12-bis(4-chlorophenyl)-19,21-dimethoxy-2,17-diphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene (PubChem CID 135627657) has the molecular formula C48H33Cl2N3O2 and a molecular weight of 754.72 g/mol. Its IUPAC name is 7,12-bis(4-chlorophenyl)-19,21-dimethoxy-2,17-diphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene.
| Compound Name | 7,12-bis(4-chlorophenyl)-19,21-dimethoxy-2,17-diphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene |
|---|---|
| PubChem CID | 135627657 |
| Molecular Formula | C48H33Cl2N3O2 |
| Molecular Weight | 754.72 g/mol |
| Exact Mass | 753.19 |
| IUPAC Name | 7,12-bis(4-chlorophenyl)-19,21-dimethoxy-2,17-diphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene |
| SMILES | COc1cc(OC)c2cc1/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccc(Cl)cc1)=c1\cc/c([nH]1)=C(/c1ccc(Cl)cc1)C1=N/C(=C\2c2ccccc2)C=C1 |
| InChI | InChI=1S/C48H33Cl2N3O2/c1-54-43-28-44(55-2)36-27-35(43)45(29-9-5-3-6-10-29)37-21-23-39(51-37)47(31-13-17-33(49)18-14-31)41-25-26-42(53-41)48(32-15-19-34(50)20-16-32)40-24-22-38(52-40)46(36)30-11-7-4-8-12-30/h3-28,53H,1-2H3/b45-37-,46-38-,47-41+,48-42+ |
| InChIKey | DSCXQCNEEFPTNQ-XGHOZTNISA-N |
| XLogP | 9.99 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.72 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |