C44H44N4O4 — CID 91500775
5,15-bis(5,5-dimethyl-1,3-dioxan-2-yl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91500775) has the molecular formula C44H44N4O4 and a molecular weight of 692.86 g/mol. Its IUPAC name is 5,15-bis(5,5-dimethyl-1,3-dioxan-2-yl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis(5,5-dimethyl-1,3-dioxan-2-yl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91500775 |
| Molecular Formula | C44H44N4O4 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 5,15-bis(5,5-dimethyl-1,3-dioxan-2-yl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC1(C)COC(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(C3OCC(C)(C)CO3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)OC1 |
| InChI | InChI=1S/C44H44N4O4/c1-43(2)23-49-41(50-24-43)39-33-19-15-29(45-33)37(27-11-7-5-8-12-27)31-17-21-35(47-31)40(42-51-25-44(3,4)26-52-42)36-22-18-32(48-36)38(28-13-9-6-10-14-28)30-16-20-34(39)46-30/h5-22,41-42,45-48H,23-26H2,1-4H3 |
| InChIKey | HUPRSSIGSROMRI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |