C51H32Br3N7 — CID 87530513
(4Z,10Z,15Z,19Z)-5,15,20-tris(5-bromo-3-pyridinyl)-10-pyren-1-yl-1,14,21,22,23,24-hexahydroporphyrin (PubChem CID 87530513) has the molecular formula C51H32Br3N7 and a molecular weight of 982.58 g/mol. Its IUPAC name is (4Z,10Z,15Z,19Z)-5,15,20-tris(5-bromo-3-pyridinyl)-10-pyren-1-yl-1,14,21,22,23,24-hexahydroporphyrin.
| Compound Name | (4Z,10Z,15Z,19Z)-5,15,20-tris(5-bromo-3-pyridinyl)-10-pyren-1-yl-1,14,21,22,23,24-hexahydroporphyrin |
|---|---|
| PubChem CID | 87530513 |
| Molecular Formula | C51H32Br3N7 |
| Molecular Weight | 982.58 g/mol |
| Exact Mass | 979.03 |
| IUPAC Name | (4Z,10Z,15Z,19Z)-5,15,20-tris(5-bromo-3-pyridinyl)-10-pyren-1-yl-1,14,21,22,23,24-hexahydroporphyrin |
| SMILES | Brc1cncc(/C2=C3\C=CC(N3)/C(c3cncc(Br)c3)=c3/cc/c([nH]3)=C(\c3cncc(Br)c3)C3C=C/C(=C(\c4ccc5ccc6cccc7ccc4c5c67)c4ccc2[nH]4)N3)c1 |
| InChI | InChI=1S/C51H32Br3N7/c52-33-18-30(21-55-24-33)48-38-10-12-40(58-38)49(31-19-34(53)25-56-22-31)42-14-16-44(60-42)51(37-9-7-29-5-4-27-2-1-3-28-6-8-36(37)47(29)46(27)28)45-17-15-43(61-45)50(41-13-11-39(48)59-41)32-20-35(54)26-57-23-32/h1-26,38,43,58-61H/b48-39-,49-40-,50-41-,51-45- |
| InChIKey | WUYNIHFXDFQYIT-PSENAFFSSA-N |
| XLogP | 10.40 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.58 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|