C54H21F15N4 — CID 91568475
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyren-1-yl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91568475) has the molecular formula C54H21F15N4 and a molecular weight of 1010.76 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyren-1-yl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyren-1-yl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91568475 |
| Molecular Formula | C54H21F15N4 |
| Molecular Weight | 1010.76 g/mol |
| Exact Mass | 1010.15 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyren-1-yl-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc([nH]3)C(c3ccc4ccc5cccc6ccc3c4c56)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C54H21F15N4/c55-40-37(41(56)47(62)52(67)46(40)61)34-25-12-10-23(70-25)33(22-9-7-20-5-4-18-2-1-3-19-6-8-21(22)32(20)31(18)19)24-11-13-26(71-24)35(38-42(57)48(63)53(68)49(64)43(38)58)28-15-17-30(73-28)36(29-16-14-27(34)72-29)39-44(59)50(65)54(69)51(66)45(39)60/h1-17,70-73H |
| InChIKey | IBYDLQASHFDXOX-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.76 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|