C46H36N4O2 — CID 76844763
methyl 4-[(5Z,10Z,14Z,19Z)-10,15,20-triphenyl-1,2,3,4,21,23-hexahydroporphyrin-5-yl]benzoate (PubChem CID 76844763) has the molecular formula C46H36N4O2 and a molecular weight of 676.82 g/mol. Its IUPAC name is methyl 4-[(5Z,10Z,14Z,19Z)-10,15,20-triphenyl-1,2,3,4,21,23-hexahydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[(5Z,10Z,14Z,19Z)-10,15,20-triphenyl-1,2,3,4,21,23-hexahydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 76844763 |
| Molecular Formula | C46H36N4O2 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | methyl 4-[(5Z,10Z,14Z,19Z)-10,15,20-triphenyl-1,2,3,4,21,23-hexahydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccccc3)=c3/cc/c([nH]3)=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4CCC2N4)C=C3)cc1 |
| InChI | InChI=1S/C46H36N4O2/c1-52-46(51)33-19-17-32(18-20-33)45-40-27-25-38(49-40)43(30-13-7-3-8-14-30)36-23-21-34(47-36)42(29-11-5-2-6-12-29)35-22-24-37(48-35)44(31-15-9-4-10-16-31)39-26-28-41(45)50-39/h2-25,27,39,41,47,50H,26,28H2,1H3/b42-34-,43-36-,44-37-,45-40- |
| InChIKey | VDJFMQDJFKXFTI-UZTXGEJUSA-N |
| XLogP | 7.18 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |