C48H36N4O4 — CID 142714027
methyl 4-[(1Z,4Z,9Z,15Z)-15-(4-methoxycarbonylphenyl)-10,14-diphenyl-21,23-dihydro-13H-porphyrin-5-yl]benzoate (PubChem CID 142714027) has the molecular formula C48H36N4O4 and a molecular weight of 732.84 g/mol. Its IUPAC name is methyl 4-[(1Z,4Z,9Z,15Z)-15-(4-methoxycarbonylphenyl)-10,14-diphenyl-21,23-dihydro-13H-porphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[(1Z,4Z,9Z,15Z)-15-(4-methoxycarbonylphenyl)-10,14-diphenyl-21,23-dihydro-13H-porphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 142714027 |
| Molecular Formula | C48H36N4O4 |
| Molecular Weight | 732.84 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | methyl 4-[(1Z,4Z,9Z,15Z)-15-(4-methoxycarbonylphenyl)-10,14-diphenyl-21,23-dihydro-13H-porphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(/C2=C3\C=CC(=N3)/C=c3/cc/c([nH]3)=C(\c3ccc(C(=O)OC)cc3)C3=N/C(=C(/c4ccccc4)C4=CCC2(c2ccccc2)N4)C=C3)cc1 |
| InChI | InChI=1S/C48H36N4O4/c1-55-46(53)33-17-13-31(14-18-33)43-38-23-21-36(49-38)29-37-22-24-42(50-37)45(32-15-19-34(20-16-32)47(54)56-2)48(35-11-7-4-8-12-35)28-27-41(52-48)44(30-9-5-3-6-10-30)40-26-25-39(43)51-40/h3-27,29,49,52H,28H2,1-2H3/b36-29-,43-38-,44-40-,45-42- |
| InChIKey | GKMURZZBQASEOT-PAQZNBDBSA-N |
| XLogP | 7.20 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.84 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |