C48H38N4O5V — CID 139253410
oxovanadium(2+);(4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20-dihydroporphyrin-21,23-diide (PubChem CID 139253410) has the molecular formula C48H38N4O5V and a molecular weight of 801.80 g/mol. Its IUPAC name is oxovanadium(2+);(4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20-dihydroporphyrin-21,23-diide.
| Compound Name | oxovanadium(2+);(4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20-dihydroporphyrin-21,23-diide |
|---|---|
| PubChem CID | 139253410 |
| Molecular Formula | C48H38N4O5V |
| Molecular Weight | 801.80 g/mol |
| Exact Mass | 801.23 |
| IUPAC Name | oxovanadium(2+);(4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20-dihydroporphyrin-21,23-diide |
| SMILES | COc1ccc(/C2=C3\C=CC([N-]3)C(c3ccc(OC)cc3)C3=N/C(=C(/c4ccc(OC)cc4)c4ccc([n-]4)/C(c4ccc(OC)cc4)=C4/C=CC2=N4)C=C3)cc1.O=[V+2] |
| InChI | InChI=1S/C48H38N4O4.O.V/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;;/h5-28,37,45H,1-4H3;;/q-2;;+2/b46-39-,47-40-,48-43-;; |
| InChIKey | GTDFURIMGOUNJJ-DPGOHCSSSA-N |
| XLogP | 9.62 |
| TPSA | 106.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.80 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |