C51H46MgN4+2 — CID 140591670
magnesium (4Z,9Z,15Z)-5-(4-tert-butylphenyl)-20-(4-ethylphenyl)-10-(4-methylphenyl)-15-phenyl-1,20-dihydroporphyrin-22,24-diium-21,23-diide (PubChem CID 140591670) has the molecular formula C51H46MgN4+2 and a molecular weight of 739.26 g/mol. Its IUPAC name is magnesium (4Z,9Z,15Z)-5-(4-tert-butylphenyl)-20-(4-ethylphenyl)-10-(4-methylphenyl)-15-phenyl-1,20-dihydroporphyrin-22,24-diium-21,23-diide.
| Compound Name | magnesium (4Z,9Z,15Z)-5-(4-tert-butylphenyl)-20-(4-ethylphenyl)-10-(4-methylphenyl)-15-phenyl-1,20-dihydroporphyrin-22,24-diium-21,23-diide |
|---|---|
| PubChem CID | 140591670 |
| Molecular Formula | C51H46MgN4+2 |
| Molecular Weight | 739.26 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | magnesium (4Z,9Z,15Z)-5-(4-tert-butylphenyl)-20-(4-ethylphenyl)-10-(4-methylphenyl)-15-phenyl-1,20-dihydroporphyrin-22,24-diium-21,23-diide |
| SMILES | CCc1ccc(C2C3=[NH+]/C(=C(/c4ccccc4)c4ccc([n-]4)/C(c4ccc(C)cc4)=C4/C=CC(=[NH+]4)/C(c4ccc(C(C)(C)C)cc4)=C4/C=CC2[N-]4)C=C3)cc1.[Mg+2] |
| InChI | InChI=1S/C51H44N4.Mg/c1-6-33-14-18-36(19-15-33)49-43-27-25-40(53-43)47(34-10-8-7-9-11-34)39-24-26-41(52-39)48(35-16-12-32(2)13-17-35)42-28-30-45(54-42)50(46-31-29-44(49)55-46)37-20-22-38(23-21-37)51(3,4)5;/h7-31,44,49H,6H2,1-5H3;/q-2;+2/p+2/b47-40-,48-42-,50-46-; |
| InChIKey | JWDHIEQPPBNKRY-QFAFKCEASA-P |
| XLogP | 7.65 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.26 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |