C51H42N4Ni — CID 23629377
5-(4-tert-butylphenyl)-10-(4-ethylphenyl)-20-(4-methylphenyl)-15-phenylporphyrin-22,24-diide;nickel(2+) (PubChem CID 23629377) has the molecular formula C51H42N4Ni and a molecular weight of 769.62 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-10-(4-ethylphenyl)-20-(4-methylphenyl)-15-phenylporphyrin-22,24-diide;nickel(2+).
| Compound Name | 5-(4-tert-butylphenyl)-10-(4-ethylphenyl)-20-(4-methylphenyl)-15-phenylporphyrin-22,24-diide;nickel(2+) |
|---|---|
| PubChem CID | 23629377 |
| Molecular Formula | C51H42N4Ni |
| Molecular Weight | 769.62 g/mol |
| Exact Mass | 768.28 |
| IUPAC Name | 5-(4-tert-butylphenyl)-10-(4-ethylphenyl)-20-(4-methylphenyl)-15-phenylporphyrin-22,24-diide;nickel(2+) |
| SMILES | CCc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Ni+2] |
| InChI | InChI=1S/C51H42N4.Ni/c1-6-33-14-18-36(19-15-33)49-43-27-25-40(53-43)47(34-10-8-7-9-11-34)39-24-26-41(52-39)48(35-16-12-32(2)13-17-35)42-28-30-45(54-42)50(46-31-29-44(49)55-46)37-20-22-38(23-21-37)51(3,4)5;/h7-31H,6H2,1-5H3;/q-2;+2/b47-39-,47-40-,48-41-,48-42-,49-43-,49-44-,50-45-,50-46-; |
| InChIKey | TUKKFZHKWIZMDV-BZEPWWCJSA-N |
| XLogP | 12.75 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.62 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |