C42H34IN3S — CID 101420093
(2Z,7Z,11Z)-12-(4-iodophenyl)-17,17-dimethyl-2,7-bis(4-methylphenyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13,15,18-decaene (PubChem CID 101420093) has the molecular formula C42H34IN3S and a molecular weight of 739.73 g/mol. Its IUPAC name is (2Z,7Z,11Z)-12-(4-iodophenyl)-17,17-dimethyl-2,7-bis(4-methylphenyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13,15,18-decaene.
| Compound Name | (2Z,7Z,11Z)-12-(4-iodophenyl)-17,17-dimethyl-2,7-bis(4-methylphenyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13,15,18-decaene |
|---|---|
| PubChem CID | 101420093 |
| Molecular Formula | C42H34IN3S |
| Molecular Weight | 739.73 g/mol |
| Exact Mass | 739.15 |
| IUPAC Name | (2Z,7Z,11Z)-12-(4-iodophenyl)-17,17-dimethyl-2,7-bis(4-methylphenyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13,15,18-decaene |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C(\c3ccc(I)cc3)c3ccc([nH]3)C(C)(C)c3ccc2s3)cc1 |
| InChI | InChI=1S/C42H34IN3S/c1-25-5-9-27(10-6-25)39-31-17-18-33(44-31)40(28-13-15-30(43)16-14-28)34-21-23-37(46-34)42(3,4)38-24-22-36(47-38)41(35-20-19-32(39)45-35)29-11-7-26(2)8-12-29/h5-24,44,46H,1-4H3/b39-31-,40-33-,41-35- |
| InChIKey | AGHKKGBYDSFIKN-MCKXPFHGSA-N |
| XLogP | 9.18 |
| TPSA | 43.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.73 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|