C51H46N4O11S3 — CID 88658399
7-[4-[(1Z,5Z,9Z,14Z)-10,15,20-tris(4-sulfophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenyl]heptanoic acid (PubChem CID 88658399) has the molecular formula C51H46N4O11S3 and a molecular weight of 987.15 g/mol. Its IUPAC name is 7-[4-[(1Z,5Z,9Z,14Z)-10,15,20-tris(4-sulfophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenyl]heptanoic acid.
| Compound Name | 7-[4-[(1Z,5Z,9Z,14Z)-10,15,20-tris(4-sulfophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 88658399 |
| Molecular Formula | C51H46N4O11S3 |
| Molecular Weight | 987.15 g/mol |
| Exact Mass | 986.23 |
| IUPAC Name | 7-[4-[(1Z,5Z,9Z,14Z)-10,15,20-tris(4-sulfophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1ccc(/C2=c3\cc/c([nH]3)=C(\c3ccc(S(=O)(=O)O)cc3)C3C=C/C(=C(\c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)/C(c4ccc(S(=O)(=O)O)cc4)=C4/C=CC2N4)N3)cc1 |
| InChI | InChI=1S/C51H46N4O11S3/c56-47(57)6-4-2-1-3-5-31-7-9-32(10-8-31)48-39-23-25-41(52-39)49(33-11-17-36(18-12-33)67(58,59)60)43-27-29-45(54-43)51(35-15-21-38(22-16-35)69(64,65)66)46-30-28-44(55-46)50(42-26-24-40(48)53-42)34-13-19-37(20-14-34)68(61,62)63/h7-30,39,44,52-55H,1-6H2,(H,56,57)(H,58,59,60)(H,61,62,63)(H,64,65,66)/b48-40-,49-41-,50-42-,51-46- |
| InChIKey | KOPQJMBSGHCABA-YLIYVTCMSA-N |
| XLogP | 6.35 |
| TPSA | 256.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.15 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|