C45H34N4O12S4 — CID 54394700
4-[24-methyl-10,15,20-tris(4-sulfophenyl)-22,23-dihydro-21H-porphyrin-5-yl]benzenesulfonic acid (PubChem CID 54394700) has the molecular formula C45H34N4O12S4 and a molecular weight of 951.05 g/mol. Its IUPAC name is 4-[24-methyl-10,15,20-tris(4-sulfophenyl)-22,23-dihydro-21H-porphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[24-methyl-10,15,20-tris(4-sulfophenyl)-22,23-dihydro-21H-porphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54394700 |
| Molecular Formula | C45H34N4O12S4 |
| Molecular Weight | 951.05 g/mol |
| Exact Mass | 950.11 |
| IUPAC Name | 4-[24-methyl-10,15,20-tris(4-sulfophenyl)-22,23-dihydro-21H-porphyrin-5-yl]benzenesulfonic acid |
| SMILES | Cn1c2ccc1=C(c1ccc(S(=O)(=O)O)cc1)c1ccc([nH]1)C(c1ccc(S(=O)(=O)O)cc1)=c1ccc([nH]1)=C(c1ccc(S(=O)(=O)O)cc1)c1ccc([nH]1)C=2c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C45H34N4O12S4/c1-49-40-24-25-41(49)45(29-8-16-33(17-9-29)65(59,60)61)39-23-21-37(48-39)43(27-4-12-31(13-5-27)63(53,54)55)35-19-18-34(46-35)42(26-2-10-30(11-3-26)62(50,51)52)36-20-22-38(47-36)44(40)28-6-14-32(15-7-28)64(56,57)58/h2-25,46-48H,1H3,(H,50,51,52)(H,53,54,55)(H,56,57,58)(H,59,60,61) |
| InChIKey | HRHXUVXMPCCRFJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 269.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.05 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|