C44H28Cl4N4O12S4 — CID 91317806
4-chloro-3-[10,15,20-tris(2-chloro-5-sulfophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 91317806) has the molecular formula C44H28Cl4N4O12S4 and a molecular weight of 1074.80 g/mol. Its IUPAC name is 4-chloro-3-[10,15,20-tris(2-chloro-5-sulfophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-chloro-3-[10,15,20-tris(2-chloro-5-sulfophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91317806 |
| Molecular Formula | C44H28Cl4N4O12S4 |
| Molecular Weight | 1074.80 g/mol |
| Exact Mass | 1071.93 |
| IUPAC Name | 4-chloro-3-[10,15,20-tris(2-chloro-5-sulfophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Cl)c(C2=c3ccc([nH]3)=C(c3cc(S(=O)(=O)O)ccc3Cl)c3ccc([nH]3)C(c3cc(S(=O)(=O)O)ccc3Cl)=c3ccc([nH]3)=C(c3cc(S(=O)(=O)O)ccc3Cl)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C44H28Cl4N4O12S4/c45-29-5-1-21(65(53,54)55)17-25(29)41-33-9-11-35(49-33)42(26-18-22(66(56,57)58)2-6-30(26)46)37-13-15-39(51-37)44(28-20-24(68(62,63)64)4-8-32(28)48)40-16-14-38(52-40)43(36-12-10-34(41)50-36)27-19-23(67(59,60)61)3-7-31(27)47/h1-20,49-52H,(H,53,54,55)(H,56,57,58)(H,59,60,61)(H,62,63,64) |
| InChIKey | ZAAGROHUSRCIJZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 280.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|