C32H24N4O9S3 — CID 54248399
3,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,10,15-trisulfonic acid (PubChem CID 54248399) has the molecular formula C32H24N4O9S3 and a molecular weight of 704.76 g/mol. Its IUPAC name is 3,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,10,15-trisulfonic acid.
| Compound Name | 3,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,10,15-trisulfonic acid |
|---|---|
| PubChem CID | 54248399 |
| Molecular Formula | C32H24N4O9S3 |
| Molecular Weight | 704.76 g/mol |
| Exact Mass | 704.07 |
| IUPAC Name | 3,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,10,15-trisulfonic acid |
| SMILES | O=S(=O)(O)C1=c2ccc([nH]2)=C(S(=O)(=O)O)c2ccc([nH]2)C(S(=O)(=O)O)=c2[nH]c(cc2-c2ccccc2)=C(c2ccccc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C32H24N4O9S3/c37-46(38,39)30-22-12-11-21(33-22)28(19-9-5-2-6-10-19)27-17-20(18-7-3-1-4-8-18)29(36-27)32(48(43,44)45)26-16-15-25(35-26)31(47(40,41)42)24-14-13-23(30)34-24/h1-17,33-36H,(H,37,38,39)(H,40,41,42)(H,43,44,45) |
| InChIKey | XLTLESBJYOFWQH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 226.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|