C46H32F3N5O — CID 136650285
N-[2,2,2-trifluoro-1-(5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethylidene]hydroxylamine (PubChem CID 136650285) has the molecular formula C46H32F3N5O and a molecular weight of 727.79 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-(5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethylidene]hydroxylamine.
| Compound Name | N-[2,2,2-trifluoro-1-(5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 136650285 |
| Molecular Formula | C46H32F3N5O |
| Molecular Weight | 727.79 g/mol |
| Exact Mass | 727.26 |
| IUPAC Name | N-[2,2,2-trifluoro-1-(5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethylidene]hydroxylamine |
| SMILES | ON=C(c1cc2[nH]c1C(c1ccccc1)=c1ccc([nH]1)=C(c1ccccc1)c1ccc([nH]1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C46H32F3N5O/c47-46(48,49)45(54-55)32-27-39-42(30-17-9-3-10-18-30)37-24-23-35(51-37)40(28-13-5-1-6-14-28)33-21-22-34(50-33)41(29-15-7-2-8-16-29)36-25-26-38(52-36)43(44(32)53-39)31-19-11-4-12-20-31/h1-27,50-53,55H |
| InChIKey | ZSSDGRSITIPMQS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.79 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|