C52H40N5+ — CID 20842654
(1Z,4Z,10Z,14Z)-2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 20842654) has the molecular formula C52H40N5+ and a molecular weight of 734.93 g/mol. Its IUPAC name is (1Z,4Z,10Z,14Z)-2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | (1Z,4Z,10Z,14Z)-2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 20842654 |
| Molecular Formula | C52H40N5+ |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.33 |
| IUPAC Name | (1Z,4Z,10Z,14Z)-2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | C[n+]1ccccc1/C=C/c1c/c2[nH]/c1=C(/c1ccccc1)c1ccc([nH]1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1ccc([nH]1)/C=2c1ccccc1 |
| InChI | InChI=1S/C52H39N5/c1-57-33-15-14-24-40(57)26-25-39-34-47-50(37-20-10-4-11-21-37)45-30-29-43(54-45)48(35-16-6-2-7-17-35)41-27-28-42(53-41)49(36-18-8-3-9-19-36)44-31-32-46(55-44)51(52(39)56-47)38-22-12-5-13-23-38/h2-34H,1H3,(H3,53,54,55,56)/p+1/b50-45- |
| InChIKey | CMXVLWPYNJPBIV-JDKRGUCDSA-O |
| XLogP | 7.30 |
| TPSA | 67.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|