C21H18N2O5S — CID 20771710
4-[2,5-dimethyl-1-(4-methylphenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzenesulfonic acid (PubChem CID 20771710) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is 4-[2,5-dimethyl-1-(4-methylphenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzenesulfonic acid.
| Compound Name | 4-[2,5-dimethyl-1-(4-methylphenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 20771710 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[2,5-dimethyl-1-(4-methylphenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzenesulfonic acid |
| SMILES | Cc1ccc(C2=C3C(=O)N(C)C(c4ccc(S(=O)(=O)O)cc4)=C3C(=O)N2C)cc1 |
| InChI | InChI=1S/C21H18N2O5S/c1-12-4-6-13(7-5-12)18-16-17(21(25)22(18)2)19(23(3)20(16)24)14-8-10-15(11-9-14)29(26,27)28/h4-11H,1-3H3,(H,26,27,28) |
| InChIKey | XAJGYTSDKJOQHS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|