C44H28N8O8 — CID 136913041
(4Z,9Z,15Z)-5,10,15,20-tetrakis(2-nitrophenyl)-1,20,21,23-tetrahydroporphyrin (PubChem CID 136913041) has the molecular formula C44H28N8O8 and a molecular weight of 796.76 g/mol. Its IUPAC name is (4Z,9Z,15Z)-5,10,15,20-tetrakis(2-nitrophenyl)-1,20,21,23-tetrahydroporphyrin.
| Compound Name | (4Z,9Z,15Z)-5,10,15,20-tetrakis(2-nitrophenyl)-1,20,21,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 136913041 |
| Molecular Formula | C44H28N8O8 |
| Molecular Weight | 796.76 g/mol |
| Exact Mass | 796.20 |
| IUPAC Name | (4Z,9Z,15Z)-5,10,15,20-tetrakis(2-nitrophenyl)-1,20,21,23-tetrahydroporphyrin |
| SMILES | O=[N+]([O-])c1ccccc1/C1=C2\C=CC(N2)C(c2ccccc2[N+](=O)[O-])C2=N/C(=C(/c3ccccc3[N+](=O)[O-])c3ccc([nH]3)/C(c3ccccc3[N+](=O)[O-])=C3/C=CC1=N3)C=C2 |
| InChI | InChI=1S/C44H28N8O8/c53-49(54)37-13-5-1-9-25(37)41-29-17-19-31(45-29)42(26-10-2-6-14-38(26)50(55)56)33-21-23-35(47-33)44(28-12-4-8-16-40(28)52(59)60)36-24-22-34(48-36)43(32-20-18-30(41)46-32)27-11-3-7-15-39(27)51(57)58/h1-24,29,41,45,48H/b42-31-,43-32-,44-35- |
| InChIKey | KQUGUTMKHQASEX-NMHUFPADSA-N |
| XLogP | 8.92 |
| TPSA | 225.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.76 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|